1-Triazene,3-(4-nitrophenyl)-1-phenyl- structure
|
Common Name | 1-Triazene,3-(4-nitrophenyl)-1-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 13113-75-2 | Molecular Weight | 242.23300 | |
| Density | 1.28g/cm3 | Boiling Point | 397.3ºC at 760mmHg | |
| Molecular Formula | C12H10N4O2 | Melting Point | 137 °C(lit.) | |
| MSDS | N/A | Flash Point | 194.1ºC | |
| Name | N-[(4-nitrophenyl)diazenyl]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 397.3ºC at 760mmHg |
| Melting Point | 137 °C(lit.) |
| Molecular Formula | C12H10N4O2 |
| Molecular Weight | 242.23300 |
| Flash Point | 194.1ºC |
| Exact Mass | 242.08000 |
| PSA | 82.57000 |
| LogP | 4.30180 |
| Vapour Pressure | 1.6E-06mmHg at 25°C |
| Index of Refraction | 1.636 |
| InChIKey | VPLPKIVQGJVXDR-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(N=NNc2ccccc2)cc1 |
| HS Code | 2928000090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 8 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 1-(4-Nitrophenyl)-3-phenyltriazene |
| p-Nitro-diazoaminobenzol |
| N'-Phenyl-N-<4-nitro-phenyl>-triazen |
| p-nitrophenylbenzotriazene |
| 4-NitrodiazoaMinobenzene |
| 4-Nitro-diazoaminobenzol |
| 1-<4-Nitro-phenyl>-3-phenyl-triazen |
| p-Nitrodiazoaminobenzene |