1-(5-nitro-1,3-thiazol-2-yl)pyrrolidin-2-one structure
|
Common Name | 1-(5-nitro-1,3-thiazol-2-yl)pyrrolidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 13109-99-4 | Molecular Weight | 213.21400 | |
| Density | 1.579g/cm3 | Boiling Point | 386.2ºC at 760 mmHg | |
| Molecular Formula | C7H7N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.4ºC | |
| Name | 1-(5-nitro-1,3-thiazol-2-yl)pyrrolidin-2-one |
|---|
| Density | 1.579g/cm3 |
|---|---|
| Boiling Point | 386.2ºC at 760 mmHg |
| Molecular Formula | C7H7N3O3S |
| Molecular Weight | 213.21400 |
| Flash Point | 187.4ºC |
| Exact Mass | 213.02100 |
| PSA | 107.26000 |
| LogP | 1.76630 |
| Vapour Pressure | 3.61E-06mmHg at 25°C |
| Index of Refraction | 1.656 |
| InChIKey | UBYUUYVSFQRSJR-UHFFFAOYSA-N |
| SMILES | O=C1CCCN1c1ncc([N+](=O)[O-])s1 |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |