2,3,5,6-tetrachloro-4-ethylsulfinylpyridine
Modify Date: 2025-08-25 21:55:16
2,3,5,6-tetrachloro-4-ethylsulfinylpyridine structure
|
Common Name | 2,3,5,6-tetrachloro-4-ethylsulfinylpyridine | ||
|---|---|---|---|---|
| CAS Number | 13108-44-6 | Molecular Weight | 292.99800 | |
| Density | 1.71g/cm3 | Boiling Point | 430.6ºC at 760 mmHg | |
| Molecular Formula | C7H5Cl4NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.2ºC | |
| Name | 2,3,5,6-tetrachloro-4-ethylsulfinylpyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.71g/cm3 |
|---|---|
| Boiling Point | 430.6ºC at 760 mmHg |
| Molecular Formula | C7H5Cl4NOS |
| Molecular Weight | 292.99800 |
| Flash Point | 214.2ºC |
| Exact Mass | 290.88500 |
| PSA | 49.17000 |
| LogP | 4.68840 |
| Vapour Pressure | 3.23E-07mmHg at 25°C |
| Index of Refraction | 1.645 |
| InChIKey | YUICRLSHFDBNQQ-UHFFFAOYSA-N |
| SMILES | CCS(=O)c1c(Cl)c(Cl)nc(Cl)c1Cl |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,3,5,6-tetrachloro-4-ethanesulfinyl-pyridine |