Benzenamine,N,N-dimethyl-4-[2-(2-pyridinyl)diazenyl]-
Modify Date: 2025-08-24 21:29:32
![Benzenamine,N,N-dimethyl-4-[2-(2-pyridinyl)diazenyl]- Structure](https://image.chemsrc.com/caspic/004/13103-75-8.png)
Benzenamine,N,N-dimethyl-4-[2-(2-pyridinyl)diazenyl]- structure
|
Common Name | Benzenamine,N,N-dimethyl-4-[2-(2-pyridinyl)diazenyl]- | ||
|---|---|---|---|---|
| CAS Number | 13103-75-8 | Molecular Weight | 226.27700 | |
| Density | 1.08g/cm3 | Boiling Point | 392.8ºC at 760mmHg | |
| Molecular Formula | C13H14N4 | Melting Point | 108-110°C | |
| MSDS | N/A | Flash Point | 191.4ºC | |
| Name | 4-(2-pyridylazo)-n,n-dimethylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.08g/cm3 |
|---|---|
| Boiling Point | 392.8ºC at 760mmHg |
| Melting Point | 108-110°C |
| Molecular Formula | C13H14N4 |
| Molecular Weight | 226.27700 |
| Flash Point | 191.4ºC |
| Exact Mass | 226.12200 |
| PSA | 40.85000 |
| LogP | 3.56300 |
| Vapour Pressure | 2.22E-06mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | IOJNPSPGHUEJAQ-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(N=Nc2ccccn2)cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| HS Code | 2933399090 |
|
~%
Benzenamine,N,N... CAS#:13103-75-8 |
| Literature: Journal of the American Chemical Society, , vol. 73, p. 4606 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD00010435 |
| 4-(2-Pyridylazo)-N,N-dimethylaniline |
| 2-(4-Dimethylaminophenylazo)pyridine |
| Pyridine-2-azo-p-dimethylaniline |
| EINECS 236-026-6 |
| N,N-dimethyl-4-(pyridin-2-yldiazenyl)aniline |