1,1,4,4-tetramethyltetramethylene peroxypivalate
Modify Date: 2025-09-23 13:25:04
1,1,4,4-tetramethyltetramethylene peroxypivalate structure
|
Common Name | 1,1,4,4-tetramethyltetramethylene peroxypivalate | ||
|---|---|---|---|---|
| CAS Number | 13102-32-4 | Molecular Weight | 346.45900 | |
| Density | 1.002g/cm3 | Boiling Point | 380.2ºC at 760mmHg | |
| Molecular Formula | C18H34O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.2ºC | |
| Name | 1,1,4,4-tetramethyltetramethylene peroxypivalate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.002g/cm3 |
|---|---|
| Boiling Point | 380.2ºC at 760mmHg |
| Molecular Formula | C18H34O6 |
| Molecular Weight | 346.45900 |
| Flash Point | 159.2ºC |
| Exact Mass | 346.23600 |
| PSA | 71.06000 |
| LogP | 4.36560 |
| Vapour Pressure | 5.56E-06mmHg at 25°C |
| Index of Refraction | 1.447 |
| InChIKey | AUZOWNCZAHHZQB-UHFFFAOYSA-N |
| SMILES | CC(C)(CCC(C)(C)OOC(=O)C(C)(C)C)OOC(=O)C(C)(C)C |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Bis(2,2-dimethylpropaneperoxoic acid)2,5-dimethyl-2,5-hexanediyl ester |
| Einecs 236-021-9 |
| 2,5-dimethyl-2,5-di(pivaloylperoxy)-hexane |