Acid-PEG5-mono-methyl ester
Modify Date: 2025-11-30 12:26:43
Acid-PEG5-mono-methyl ester structure
|
Common Name | Acid-PEG5-mono-methyl ester | ||
|---|---|---|---|---|
| CAS Number | 1309460-30-7 | Molecular Weight | 352.377 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 469.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C15H28O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.3±22.2 °C | |
Use of Acid-PEG5-mono-methyl esterAcid-PEG5-mono-methyl ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Acid-PEG5-mono-methyl ester |
|---|---|
| Synonym | More Synonyms |
| Description | Acid-PEG5-mono-methyl ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 469.4±45.0 °C at 760 mmHg |
| Molecular Formula | C15H28O9 |
| Molecular Weight | 352.377 |
| Flash Point | 161.3±22.2 °C |
| Exact Mass | 352.173340 |
| LogP | -1.44 |
| Vapour Pressure | 0.0±2.5 mmHg at 25°C |
| Index of Refraction | 1.459 |
| InChIKey | LSGMOHWEFFVQEO-UHFFFAOYSA-N |
| SMILES | COC(=O)CCOCCOCCOCCOCCOCCC(=O)O |
| 3-Oxo-2,6,9,12,15,18-hexaoxahenicosan-21-oic acid |
| MFCD18916990 |
| 4,7,10,13,16-Pentaoxanonadecane-1,19-dioic acid, monomethyl ester |