benzoic acid, compound with 2,2',2''-nitrilotriethanol (1:1)
Modify Date: 2024-02-07 10:01:04
benzoic acid, compound with 2,2',2''-nitrilotriethanol (1:1) structure
|
Common Name | benzoic acid, compound with 2,2',2''-nitrilotriethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 13090-86-3 | Molecular Weight | 271.31000 | |
| Density | N/A | Boiling Point | 518.5ºC at 760 mmHg | |
| Molecular Formula | C13H21NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.4ºC | |
| Name | benzoic acid,2-[bis(2-hydroxyethyl)amino]ethanol |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 518.5ºC at 760 mmHg |
|---|---|
| Molecular Formula | C13H21NO5 |
| Molecular Weight | 271.31000 |
| Flash Point | 267.4ºC |
| Exact Mass | 271.14200 |
| PSA | 101.23000 |
| Vapour Pressure | 1.41E-11mmHg at 25°C |
| InChIKey | LBCOWMYTAXJNER-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1.OCCN(CCO)CCO |
| Benzoic acid,compound with 2,2',2''-nitrilotriethanol (1:1) |
| EINECS 236-002-5 |
| UNII-M3EN4GC19W |
| M3EN4GC19W |
| Benzoic acid,compd. with 2,2',2''-nitrilotris(ethanol) (1:1) |