1-O-[2-(diethylamino)ethyl] 3-O-ethyl 2-butyl-2-ethylpropanedioate
Modify Date: 2025-08-22 21:07:02
![1-O-[2-(diethylamino)ethyl] 3-O-ethyl 2-butyl-2-ethylpropanedioate Structure](https://image.chemsrc.com/caspic/491/13080-06-3.png)
1-O-[2-(diethylamino)ethyl] 3-O-ethyl 2-butyl-2-ethylpropanedioate structure
|
Common Name | 1-O-[2-(diethylamino)ethyl] 3-O-ethyl 2-butyl-2-ethylpropanedioate | ||
|---|---|---|---|---|
| CAS Number | 13080-06-3 | Molecular Weight | 315.44800 | |
| Density | 0.975g/cm3 | Boiling Point | 374.9ºC at 760 mmHg | |
| Molecular Formula | C17H33NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.5ºC | |
| Name | 1-O-[2-(diethylamino)ethyl] 3-O-ethyl 2-butyl-2-ethylpropanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.975g/cm3 |
|---|---|
| Boiling Point | 374.9ºC at 760 mmHg |
| Molecular Formula | C17H33NO4 |
| Molecular Weight | 315.44800 |
| Flash Point | 180.5ºC |
| Exact Mass | 315.24100 |
| PSA | 55.84000 |
| LogP | 3.02110 |
| Vapour Pressure | 8.1E-06mmHg at 25°C |
| Index of Refraction | 1.456 |
| InChIKey | CQXNKORKKPMCPE-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)(C(=O)OCC)C(=O)OCCN(CC)CC |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Sch 5712 |