4-[2-(benzylamino)ethyl]benzene-1,2-diol,hydrochloride
Modify Date: 2025-09-21 13:22:43
![4-[2-(benzylamino)ethyl]benzene-1,2-diol,hydrochloride Structure](https://image.chemsrc.com/caspic/259/13075-94-0.png)
4-[2-(benzylamino)ethyl]benzene-1,2-diol,hydrochloride structure
|
Common Name | 4-[2-(benzylamino)ethyl]benzene-1,2-diol,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 13075-94-0 | Molecular Weight | 279.76200 | |
| Density | N/A | Boiling Point | 434.5ºC at 760mmHg | |
| Molecular Formula | C15H18ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.8ºC | |
| Name | 4-[2-(benzylamino)ethyl]benzene-1,2-diol,hydrochloride |
|---|
| Boiling Point | 434.5ºC at 760mmHg |
|---|---|
| Molecular Formula | C15H18ClNO2 |
| Molecular Weight | 279.76200 |
| Flash Point | 161.8ºC |
| Exact Mass | 279.10300 |
| PSA | 52.49000 |
| LogP | 3.62300 |
| Vapour Pressure | 3.72E-08mmHg at 25°C |
| InChIKey | HXNCHYNGCFOTGC-UHFFFAOYSA-N |
| SMILES | Cl.Oc1ccc(CCNCc2ccccc2)cc1O |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |