Phosphoric acid 3-isopropyl-4-nitrophenyldimethyl ester structure
|
Common Name | Phosphoric acid 3-isopropyl-4-nitrophenyldimethyl ester | ||
|---|---|---|---|---|
| CAS Number | 13074-11-8 | Molecular Weight | 289.22200 | |
| Density | 1.264g/cm3 | Boiling Point | 364.2ºC at 760mmHg | |
| Molecular Formula | C11H16NO6P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.1ºC | |
| Name | dimethyl (4-nitro-3-propan-2-ylphenyl) phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.264g/cm3 |
|---|---|
| Boiling Point | 364.2ºC at 760mmHg |
| Molecular Formula | C11H16NO6P |
| Molecular Weight | 289.22200 |
| Flash Point | 174.1ºC |
| Exact Mass | 289.07200 |
| PSA | 100.39000 |
| LogP | 4.02110 |
| Vapour Pressure | 3.59E-05mmHg at 25°C |
| Index of Refraction | 1.512 |
| InChIKey | FFXJBGZEAHBHCF-UHFFFAOYSA-N |
| SMILES | COP(=O)(OC)Oc1ccc([N+](=O)[O-])c(C(C)C)c1 |
| HS Code | 2919900090 |
|---|
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| Dimethyl 3-isopropyl-4-nitrophenyl phosphate |
| Phosphoric acid,dimethyl 3-isopropyl-4-nitrophenyl ester |