1,1,1,3,3,3-hexafluoro-2-nitropropane structure
|
Common Name | 1,1,1,3,3,3-hexafluoro-2-nitropropane | ||
|---|---|---|---|---|
| CAS Number | 13071-90-4 | Molecular Weight | 197.03600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C3HF6NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,1,3,3,3-hexafluoro-2-nitropropane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C3HF6NO2 |
|---|---|
| Molecular Weight | 197.03600 |
| Exact Mass | 196.99100 |
| PSA | 45.82000 |
| LogP | 2.27950 |
| InChIKey | CNDXTMNJDISJMM-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])C(C(F)(F)F)C(F)(F)F |
|
~78%
1,1,1,3,3,3-hex... CAS#:13071-90-4 |
| Literature: Fokin, A. V.; Rapkin, A. I.; Krylov, I. N.; Kutenov, A. P.; Studnev, Yu. N. Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), 1986 , vol. 35, # 10 p. 2165 - 2168 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, 1986 , # 10 p. 2364 - 2367 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| 1,1,1,3,3,3-hexafluoro-2-nitro-propane |
| 2-nitro-2-hydrohexafluoropropane |
| 2H-Hexafluor-2-nitropropan |
| 1,1,1,3,3,3-Hexafluor-2-nitropropan |
| Propane,1,1,1,3,3,3-hexafluoro-2-nitro |
| 2-nitrohexafluoropropane |