butyl 3,4-dichlorobenzoate structure
|
Common Name | butyl 3,4-dichlorobenzoate | ||
|---|---|---|---|---|
| CAS Number | 13050-59-4 | Molecular Weight | 247.11800 | |
| Density | 1.23g/cm3 | Boiling Point | 312.4ºC at 760mmHg | |
| Molecular Formula | C11H12Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | butyl 3,4-dichlorobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 312.4ºC at 760mmHg |
| Molecular Formula | C11H12Cl2O2 |
| Molecular Weight | 247.11800 |
| Exact Mass | 246.02100 |
| PSA | 26.30000 |
| LogP | 3.95030 |
| Vapour Pressure | 0.000529mmHg at 25°C |
| Index of Refraction | 1.526 |
| InChIKey | UCRKKARYPUKFGN-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)c1ccc(Cl)c(Cl)c1 |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3,4-Dichlor-benzoesaeure-butylester |