4,5,6,7-Tetrabromophenolphthalein
Modify Date: 2025-09-18 14:31:04
4,5,6,7-Tetrabromophenolphthalein structure
|
Common Name | 4,5,6,7-Tetrabromophenolphthalein | ||
|---|---|---|---|---|
| CAS Number | 13027-28-6 | Molecular Weight | 633.90700 | |
| Density | 2.152g/cm3 | Boiling Point | 726.5ºC at 760mmHg | |
| Molecular Formula | C20H10Br4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 393.2ºC | |
| Name | 4,5,6,7-tetrabromo-3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 2.152g/cm3 |
|---|---|
| Boiling Point | 726.5ºC at 760mmHg |
| Molecular Formula | C20H10Br4O4 |
| Molecular Weight | 633.90700 |
| Flash Point | 393.2ºC |
| Exact Mass | 629.73100 |
| PSA | 66.76000 |
| LogP | 6.61010 |
| Vapour Pressure | 8.22E-22mmHg at 25°C |
| Index of Refraction | 1.74 |
| InChIKey | GNJLVMKERYSIAI-UHFFFAOYSA-N |
| SMILES | O=C1OC(c2ccc(O)cc2)(c2ccc(O)cc2)c2c(Br)c(Br)c(Br)c(Br)c21 |
|
~%
4,5,6,7-Tetrabr... CAS#:13027-28-6 |
| Literature: Journal of the American Chemical Society, , vol. 41, p. 1291 |
|
~%
4,5,6,7-Tetrabr... CAS#:13027-28-6 |
| Literature: Archiv der Pharmazie (Weinheim, Germany), , vol. 249, p. 57 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| phenol-4,5,6,7-tetrabromophthalein |
| 4,5,6,7-Tetrabrom-3,3-bis-(4-hydroxy-phenyl)-phthalid |
| Phenoltetrabromophthalein |
| Phenoltetrabromphthalein |
| EINECS 235-889-6 |
| TETRABROMOPHENOLPHTHALEIN,Na |
| 4,5,6,7-Tetrabromophenolphthalein |
| 4,5,6,7-tetrabromo-3,3-bis-(4-hydroxy-phenyl)-phthalide |
| 1(3H)-Isobenzofuranone,4,5,6,7-tetrabromo-3,3-bis(4-hydroxyphenyl) |