[Bis(dimethylamino)methyleneamino]bis(dimethylamino)phosphine oxide
Modify Date: 2025-09-18 16:58:52
![[Bis(dimethylamino)methyleneamino]bis(dimethylamino)phosphine oxide Structure](https://image.chemsrc.com/caspic/157/13012-98-1.png)
[Bis(dimethylamino)methyleneamino]bis(dimethylamino)phosphine oxide structure
|
Common Name | [Bis(dimethylamino)methyleneamino]bis(dimethylamino)phosphine oxide | ||
|---|---|---|---|---|
| CAS Number | 13012-98-1 | Molecular Weight | 249.29400 | |
| Density | 1.05g/cm3 | Boiling Point | 297.5ºC at 760 mmHg | |
| Molecular Formula | C9H24N5OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 133.7ºC | |
| Name | 2-[bis(dimethylamino)phosphoryl]-1,1,3,3-tetramethylguanidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.05g/cm3 |
|---|---|
| Boiling Point | 297.5ºC at 760 mmHg |
| Molecular Formula | C9H24N5OP |
| Molecular Weight | 249.29400 |
| Flash Point | 133.7ºC |
| Exact Mass | 249.17200 |
| PSA | 52.20000 |
| LogP | 0.69690 |
| Vapour Pressure | 0.00135mmHg at 25°C |
| Index of Refraction | 1.497 |
| InChIKey | HRLGWPJKGSKFTP-UHFFFAOYSA-N |
| SMILES | CN(C)C(=NP(=O)(N(C)C)N(C)C)N(C)C |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| N,N,N',N'-Tetramethyl-P-tetramethylguanidino-phosphonic diamide |