N-[(4-chlorophenyl)methyl]-3-[2-(pyridine-4-carbonyl)hydrazinyl]propanamide
Modify Date: 2025-09-29 04:09:23
![N-[(4-chlorophenyl)methyl]-3-[2-(pyridine-4-carbonyl)hydrazinyl]propanamide Structure](https://image.chemsrc.com/caspic/233/13012-74-3.png)
N-[(4-chlorophenyl)methyl]-3-[2-(pyridine-4-carbonyl)hydrazinyl]propanamide structure
|
Common Name | N-[(4-chlorophenyl)methyl]-3-[2-(pyridine-4-carbonyl)hydrazinyl]propanamide | ||
|---|---|---|---|---|
| CAS Number | 13012-74-3 | Molecular Weight | 332.78500 | |
| Density | 1.28g/cm3 | Boiling Point | 560.7ºC at 760mmHg | |
| Molecular Formula | C16H17ClN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 292.9ºC | |
| Name | N-[(4-chlorophenyl)methyl]-3-[2-(pyridine-4-carbonyl)hydrazinyl]propanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 560.7ºC at 760mmHg |
| Molecular Formula | C16H17ClN4O2 |
| Molecular Weight | 332.78500 |
| Flash Point | 292.9ºC |
| Exact Mass | 332.10400 |
| PSA | 86.61000 |
| LogP | 3.29800 |
| Vapour Pressure | 1.34E-12mmHg at 25°C |
| Index of Refraction | 1.596 |
| InChIKey | JFCLDVTWLBPXFS-UHFFFAOYSA-N |
| SMILES | O=C(CCNNC(=O)c1ccncc1)NCc1ccc(Cl)cc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| ISONICOTINIC ACID,2-(2-((p-CHLOROBENZYL)CARBAMOYL)ETHYL)HYDRAZIDE |
| 3-(N'-Isonicotinoyl-hydrazino)-propionsaeure-(4-chlor-benzylamid) |
| P 1205 |