sodium,2-methylpropyl 2-methylprop-2-enoate,prop-2-enoate
Modify Date: 2025-08-25 07:07:10
sodium,2-methylpropyl 2-methylprop-2-enoate,prop-2-enoate structure
|
Common Name | sodium,2-methylpropyl 2-methylprop-2-enoate,prop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 129984-35-6 | Molecular Weight | 236.24000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H17NaO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | sodium,2-methylpropyl 2-methylprop-2-enoate,prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H17NaO4 |
|---|---|
| Molecular Weight | 236.24000 |
| Exact Mass | 236.10200 |
| PSA | 66.43000 |
| LogP | 0.68400 |
| InChIKey | DKHUPGFBMQQDID-UHFFFAOYSA-M |
| SMILES | C=C(C)C(=O)OCC(C)C.C=CC(=O)[O-].[Na+] |
| Sodium acrylate,isobutyl methacrylate polymer |
| 2-Propenoic acid,2-methyl-,2-methylpropyl ester,polymer with 2-propenoic acid,sodium salt |
| 2-Propenoic acid,2-methyl-,2-methylpropyl ester,polymer with sodium 2-propenoate |