2-[4-(2-Methyl-allyl)-piperazin-1-yl]-4-pentyloxy-quinazoline; compound with (E)-but-2-enedioic acid structure
|
Common Name | 2-[4-(2-Methyl-allyl)-piperazin-1-yl]-4-pentyloxy-quinazoline; compound with (E)-but-2-enedioic acid | ||
|---|---|---|---|---|
| CAS Number | 129664-22-8 | Molecular Weight | 470.56100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H34N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[4-(2-Methyl-allyl)-piperazin-1-yl]-4-pentyloxy-quinazoline; compound with (E)-but-2-enedioic acid |
|---|
| Molecular Formula | C25H34N4O5 |
|---|---|
| Molecular Weight | 470.56100 |
| Exact Mass | 470.25300 |
| PSA | 116.09000 |
| LogP | 3.61160 |
| InChIKey | TZGKKRWAHYXYDS-WLHGVMLRSA-N |
| SMILES | C=C(C)CN1CCN(c2nc(OCCCCC)c3ccccc3n2)CC1.O=C(O)C=CC(=O)O |