4-[(E)-(3-methyl-4-nitro-1H-imidazol-2-ylidene)methyl]iminocyclohexa-2,5-dien-1-one
Modify Date: 2025-09-18 18:57:12
![4-[(E)-(3-methyl-4-nitro-1H-imidazol-2-ylidene)methyl]iminocyclohexa-2,5-dien-1-one Structure](https://image.chemsrc.com/caspic/469/129661-59-2.png)
4-[(E)-(3-methyl-4-nitro-1H-imidazol-2-ylidene)methyl]iminocyclohexa-2,5-dien-1-one structure
|
Common Name | 4-[(E)-(3-methyl-4-nitro-1H-imidazol-2-ylidene)methyl]iminocyclohexa-2,5-dien-1-one | ||
|---|---|---|---|---|
| CAS Number | 129661-59-2 | Molecular Weight | 246.22200 | |
| Density | 1.4g/cm3 | Boiling Point | 348.2ºC at 760mmHg | |
| Molecular Formula | C11H10N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.4ºC | |
| Name | 4-[(E)-(3-methyl-4-nitro-1H-imidazol-2-ylidene)methyl]iminocyclohexa-2,5-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 348.2ºC at 760mmHg |
| Molecular Formula | C11H10N4O3 |
| Molecular Weight | 246.22200 |
| Flash Point | 164.4ºC |
| Exact Mass | 246.07500 |
| PSA | 95.97000 |
| LogP | 0.93980 |
| Vapour Pressure | 5.12E-05mmHg at 25°C |
| Index of Refraction | 1.66 |
| InChIKey | JYMLHWOHOSLLAE-UHFFFAOYSA-N |
| SMILES | Cn1c([N+](=O)[O-])cnc1C=Nc1ccc(O)cc1 |
|
~78%
4-[(E)-(3-methy... CAS#:129661-59-2 |
| Literature: Vanelle; Maldonado; Jentzer; Crozet; Savornin; Delmas; Gasquet; Timon-David European Journal of Medicinal Chemistry, 1990 , vol. 25, # 4 p. 321 - 325 |
|
~%
4-[(E)-(3-methy... CAS#:129661-59-2 |
| Literature: Vanelle; Maldonado; Jentzer; Crozet; Savornin; Delmas; Gasquet; Timon-David European Journal of Medicinal Chemistry, 1990 , vol. 25, # 4 p. 321 - 325 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| methyl-1 hydroxy-4' phenyliminomethyl-2 nitro-5 imidazole |