6,8-dianilinonaphthalene-1-sulfonic acid
Modify Date: 2025-08-23 10:32:34
6,8-dianilinonaphthalene-1-sulfonic acid structure
|
Common Name | 6,8-dianilinonaphthalene-1-sulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 129-93-1 | Molecular Weight | 390.45500 | |
| Density | 1.402g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C22H18N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6,8-dianilinonaphthalene-1-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.402g/cm3 |
|---|---|
| Molecular Formula | C22H18N2O3S |
| Molecular Weight | 390.45500 |
| Exact Mass | 390.10400 |
| PSA | 86.81000 |
| LogP | 6.80050 |
| Index of Refraction | 1.732 |
| InChIKey | USFSONWQSVCJBO-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1cccc2cc(Nc3ccccc3)cc(Nc3ccccc3)c12 |
| HS Code | 2921499090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
CAS#:129-91-9
CAS#:142-04-1| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1,3-dianilinonaphthalene-8-sulphonic acid |
| N.N'-Diphenyl-naphthylendiamin-(1.3)-sulfonsaeure-(8) |
| 6,8-Dianilino-naphthalin-1-sulfonsaeure |
| EINECS 204-970-8 |
| 6,8-Dianilino-1-naphthalenesulfonic acid |
| 6,8-Diphenylamino-1-naphthalenesulfonic acid |
| 6,8-dianilino-naphthalene-1-sulfonic acid |