TMP-153
Modify Date: 2025-09-07 21:14:00
TMP-153 structure
|
Common Name | TMP-153 | ||
|---|---|---|---|---|
| CAS Number | 128831-46-9 | Molecular Weight | 437.869 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 489.0±45.0 °C at 760 mmHg | |
| Molecular Formula | C24H18ClF2N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.6±28.7 °C | |
Use of TMP-153TMP-153 is a potent acyl-CoA:cholesterol acyltransferase (ACAT) inhibitor with IC50 of 5-10 nM for the hepatic and intestinal ACAT from various animals. |
| Name | 1-[4-(2-chlorophenyl)-6,7-dimethylquinolin-3-yl]-3-(2,4-difluorophenyl)urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 489.0±45.0 °C at 760 mmHg |
| Molecular Formula | C24H18ClF2N3O |
| Molecular Weight | 437.869 |
| Flash Point | 249.6±28.7 °C |
| Exact Mass | 437.110657 |
| PSA | 54.02000 |
| LogP | 6.97 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.687 |
| InChIKey | FFKNNBNIAHVVCU-UHFFFAOYSA-N |
| SMILES | Cc1cc2ncc(NC(=O)Nc3ccc(F)cc3F)c(-c3ccccc3Cl)c2cc1C |
| CDQDU |
| Tmp 153 |
| Urea, N-[4-(2-chlorophenyl)-6,7-dimethyl-3-quinolinyl]-N'-(2,4-difluorophenyl)- |
| 1-[4-(2-Chlorophenyl)-6,7-dimethyl-3-quinolinyl]-3-(2,4-difluorophenyl)urea |
| 1-[4-(2-Chlorophenyl)-6,7-dimethylquinolin-3-yl]-3-(2,4-difluorophenyl)urea |