4-chloro-6-(4-methylphenyl)-2-(methylthio)pyrimidine-5-carbonitrile structure
|
Common Name | 4-chloro-6-(4-methylphenyl)-2-(methylthio)pyrimidine-5-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 128640-74-4 | Molecular Weight | 275.75700 | |
| Density | 1.35g/cm3 | Boiling Point | 475.2ºC at 760 mmHg | |
| Molecular Formula | C13H10ClN3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.2ºC | |
| Name | 4-chloro-6-(4-methylphenyl)-2-methylsulfanylpyrimidine-5-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 475.2ºC at 760 mmHg |
| Molecular Formula | C13H10ClN3S |
| Molecular Weight | 275.75700 |
| Flash Point | 241.2ºC |
| Exact Mass | 275.02800 |
| PSA | 74.87000 |
| LogP | 3.69898 |
| Vapour Pressure | 3.39E-09mmHg at 25°C |
| Index of Refraction | 1.646 |
| InChIKey | ASPBFSRVAPVCDU-UHFFFAOYSA-N |
| SMILES | CSc1nc(Cl)c(C#N)c(-c2ccc(C)cc2)n1 |
| RIDADR | UN3439 |
|---|---|
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2933599090 |
|
~77%
4-chloro-6-(4-m... CAS#:128640-74-4 |
| Literature: Ram, Vishnu J. Journal fuer Praktische Chemie (Leipzig), 1989 , vol. 331, # 6 p. 957 - 963 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD00975766 |