(R)-3-(3'-Acetylbiphenyl-4-yl)-2-aminopropanoic acid hydrochloride
Modify Date: 2025-11-14 18:40:32
(R)-3-(3'-Acetylbiphenyl-4-yl)-2-aminopropanoic acid hydrochloride structure
|
Common Name | (R)-3-(3'-Acetylbiphenyl-4-yl)-2-aminopropanoic acid hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1284163-33-2 | Molecular Weight | 319.78300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H18ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (R)-3-(3'-Acetylbiphenyl-4-yl)-2-aminopropanoic acid hydrochloride |
|---|
| Molecular Formula | C17H18ClNO3 |
|---|---|
| Molecular Weight | 319.78300 |
| Exact Mass | 319.09800 |
| PSA | 80.39000 |
| LogP | 4.01290 |
| InChIKey | CTRQTIFZXPXAAO-PKLMIRHRSA-N |
| SMILES | CC(=O)c1cccc(-c2ccc(CC(N)C(=O)O)cc2)c1.Cl |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |