(RS)-(1-naphthylmethyl)succinic acid structure
|
Common Name | (RS)-(1-naphthylmethyl)succinic acid | ||
|---|---|---|---|---|
| CAS Number | 128318-37-6 | Molecular Weight | 258.26900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (RS)-(1-naphthylmethyl)succinic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H14O4 |
|---|---|
| Molecular Weight | 258.26900 |
| Exact Mass | 258.08900 |
| PSA | 74.60000 |
| LogP | 2.55780 |
| InChIKey | IAQHIBLUEJOQEX-UHFFFAOYSA-N |
| SMILES | O=C(O)CC(Cc1cccc2ccccc12)C(=O)O |
|
~%
(RS)-(1-naphthy... CAS#:128318-37-6 |
| Literature: Bardhan et al. Journal of the Chemical Society, 1956 , p. 355,357 |
| [1]naphthylmethyl-succinic acid |
| .[1]Naphthylmethyl-bernsteinsaeure |
| .[Naphthyl-(1)-methyl]-bernsteinsaeure |