1,1'-iminobis(4-nitroanthraquinone) structure
|
Common Name | 1,1'-iminobis(4-nitroanthraquinone) | ||
|---|---|---|---|---|
| CAS Number | 128-88-1 | Molecular Weight | 519.41800 | |
| Density | 1.631g/cm3 | Boiling Point | 798.7ºC at 760 mmHg | |
| Molecular Formula | C28H13N3O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 436.9ºC | |
| Name | 1-nitro-4-[(4-nitro-9,10-dioxoanthracen-1-yl)amino]anthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.631g/cm3 |
|---|---|
| Boiling Point | 798.7ºC at 760 mmHg |
| Molecular Formula | C28H13N3O8 |
| Molecular Weight | 519.41800 |
| Flash Point | 436.9ºC |
| Exact Mass | 519.07000 |
| PSA | 171.95000 |
| LogP | 5.91680 |
| Vapour Pressure | 1.6E-25mmHg at 25°C |
| Index of Refraction | 1.779 |
| InChIKey | NCGPNEIWMXIRRC-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)c2c([N+](=O)[O-])ccc(Nc3ccc([N+](=O)[O-])c4c3C(=O)c3ccccc3C4=O)c21 |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4,4'-Dinitro-1,1'-dianthrimid |
| 4,4'-Dinitro-1,1'-imino-di-anthrachinon |
| 4,4'-dinitro-1,1'-imino-di-anthraquinone |
| EINECS 204-915-8 |