staphyloferrin A
Modify Date: 2025-09-07 17:48:58
staphyloferrin A structure
|
Common Name | staphyloferrin A | ||
|---|---|---|---|---|
| CAS Number | 127902-98-1 | Molecular Weight | 480.37700 | |
| Density | 1.658g/cm3 | Boiling Point | 949.4ºC at 760mmHg | |
| Molecular Formula | C17H24N2O14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 528ºC | |
Use of staphyloferrin AStaphyloferrin A is a siderophore protein that can be combined with antibiotics to study drug-resistant bacteria that cause skin diseases[1]. |
| Name | staphyloferrin A |
|---|---|
| Synonym | More Synonyms |
| Description | Staphyloferrin A is a siderophore protein that can be combined with antibiotics to study drug-resistant bacteria that cause skin diseases[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.658g/cm3 |
|---|---|
| Boiling Point | 949.4ºC at 760mmHg |
| Molecular Formula | C17H24N2O14 |
| Molecular Weight | 480.37700 |
| Flash Point | 528ºC |
| Exact Mass | 480.12300 |
| PSA | 292.14000 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | VJSIXUQLTJCRCS-UHFFFAOYSA-N |
| SMILES | O=C(O)CC(O)(CC(=O)NCCCC(NC(=O)CC(O)(CC(=O)O)C(=O)O)C(=O)O)C(=O)O |
| 2-[2-[[4-carboxy-4-[(3,4-dicarboxy-3-hydroxybutanoyl)amino]butyl]amino]-2-oxoethyl]-2-hydroxybutanedioic acid |
| Staphyloferrin A |