(5E)-2-Mercapto-5-[4-(methylthio)benzylidene]-1,3-thiazol-4(5H)-one structure
|
Common Name | (5E)-2-Mercapto-5-[4-(methylthio)benzylidene]-1,3-thiazol-4(5H)-one | ||
|---|---|---|---|---|
| CAS Number | 127378-28-3 | Molecular Weight | 267.39000 | |
| Density | 1.45g/cm3 | Boiling Point | 432.3ºC at 760 mmHg | |
| Molecular Formula | C11H9NOS3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.3ºC | |
| Name | (5E)-2-Mercapto-5-[4-(methylthio)benzylidene]-1,3-thiazol-4(5H)-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 432.3ºC at 760 mmHg |
| Molecular Formula | C11H9NOS3 |
| Molecular Weight | 267.39000 |
| Flash Point | 215.3ºC |
| Exact Mass | 266.98500 |
| PSA | 118.83000 |
| LogP | 2.74420 |
| Vapour Pressure | 1.12E-07mmHg at 25°C |
| Index of Refraction | 1.741 |
| InChIKey | SEIFTQHMDCKSIB-TWGQIWQCSA-N |
| SMILES | CSc1ccc(C=C2SC(=S)NC2=O)cc1 |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| akos b018340 |