Lasiocarpine N-oxide structure
|
Common Name | Lasiocarpine N-oxide | ||
|---|---|---|---|---|
| CAS Number | 127-30-0 | Molecular Weight | 427.49 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H33NO8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Lasiocarpine N-oxideLasiocarpine N-oxide is a natural compound with antitumor activity[1]. |
| Name | [7-[(E)-2-methylbut-2-enoyl]oxy-4-oxido-5,6,7,8-tetrahydro-3H-pyrrolizin-4-ium-1-yl]methyl 2,3-dihydroxy-2-(1-methoxyethyl)-3-methylbutanoate |
|---|---|
| Synonym | More Synonyms |
| Description | Lasiocarpine N-oxide is a natural compound with antitumor activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C21H33NO8 |
|---|---|
| Molecular Weight | 427.49 |
| Exact Mass | 427.22100 |
| PSA | 131.72000 |
| LogP | 0.93020 |
| InChIKey | AABILZKQMVKFHP-LZUZPLOVSA-N |
| SMILES | CC=C(C)C(=O)OC1CC[N+]2([O-])CC=C(COC(=O)C(O)(C(C)OC)C(C)(C)O)C12 |
| RIDADR | UN 1544 |
|---|---|
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| Lasiocarpine N-oxide |