1,2,15,16-tetrahydrotanshiquinone structure
|
Common Name | 1,2,15,16-tetrahydrotanshiquinone | ||
|---|---|---|---|---|
| CAS Number | 126979-84-8 | Molecular Weight | 280.31800 | |
| Density | 1.29g/cm3 | Boiling Point | 470ºC at 760mmHg | |
| Molecular Formula | C18H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.2ºC | |
Use of 1,2,15,16-tetrahydrotanshiquinoneTrijuganone B (Tetrahydro tanshinone I) can be extracted from from the roots of Salvia miltiorrhiza f. alba. Trijuganone B inhibits the proliferation of leukemia cells[1][2]. |
| Name | 1,6-dimethyl-1,2,8,9-tetrahydronaphtho[1,2-g][1]benzofuran-10,11-dione |
|---|---|
| Synonym | More Synonyms |
| Description | Trijuganone B (Tetrahydro tanshinone I) can be extracted from from the roots of Salvia miltiorrhiza f. alba. Trijuganone B inhibits the proliferation of leukemia cells[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 470ºC at 760mmHg |
| Molecular Formula | C18H16O3 |
| Molecular Weight | 280.31800 |
| Flash Point | 210.2ºC |
| Exact Mass | 280.11000 |
| PSA | 43.37000 |
| LogP | 3.17890 |
| Vapour Pressure | 5.24E-09mmHg at 25°C |
| Index of Refraction | 1.634 |
| InChIKey | AZIUYJPOBCMPON-UHFFFAOYSA-N |
| SMILES | CC1=CCCc2c1ccc1c2C(=O)C(=O)C2=C1OCC2C |
| 1,2,5,6-Tetrahydrotanshinone |
| trijuganone B |
| 1,2,15,16-Tetrahydrotanshiquinone |