2-Methyl-2-(2-nitrophenyl)propanoicacid structure
|
Common Name | 2-Methyl-2-(2-nitrophenyl)propanoicacid | ||
|---|---|---|---|---|
| CAS Number | 126802-52-6 | Molecular Weight | 209.19900 | |
| Density | 1.286g/cm3 | Boiling Point | 363.1ºC at 760 mmHg | |
| Molecular Formula | C10H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.7ºC | |
| Name | 2-Methyl-2-(2-nitrophenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.286g/cm3 |
|---|---|
| Boiling Point | 363.1ºC at 760 mmHg |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.19900 |
| Flash Point | 157.7ºC |
| Exact Mass | 209.06900 |
| PSA | 83.12000 |
| LogP | 2.48020 |
| Vapour Pressure | 6.58E-06mmHg at 25°C |
| Index of Refraction | 1.562 |
| InChIKey | MBYUEHBQZXQBKX-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)c1ccccc1[N+](=O)[O-] |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| MFCD11036963 |