4,4'-(m-Phenylenedioxy)diphenol structure
|
Common Name | 4,4'-(m-Phenylenedioxy)diphenol | ||
|---|---|---|---|---|
| CAS Number | 126716-90-3 | Molecular Weight | 294.301 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 478.2±40.0 °C at 760 mmHg | |
| Molecular Formula | C18H14O4 | Melting Point | 130ºC | |
| MSDS | N/A | Flash Point | 243.0±27.3 °C | |
| Name | 1,3-Bis(4-hydroxyphenoxy)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 478.2±40.0 °C at 760 mmHg |
| Melting Point | 130ºC |
| Molecular Formula | C18H14O4 |
| Molecular Weight | 294.301 |
| Flash Point | 243.0±27.3 °C |
| Exact Mass | 294.089203 |
| PSA | 58.92000 |
| LogP | 4.49 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.649 |
| InChIKey | CJLPIPXJJJUBIV-UHFFFAOYSA-N |
| SMILES | Oc1ccc(Oc2cccc(Oc3ccc(O)cc3)c2)cc1 |
| HS Code | 2909500000 |
|---|
| HS Code | 2909500000 |
|---|---|
| Summary | 2909500000 ether-phenols, ether-alcohol-phenols and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4-[3-(4-Hydroxyphenoxy)phenoxy]phenol |
| Phenol, 4,4'-[1,3-phenylenebis(oxy)]bis- |
| Resorcinol Bis(4-hydroxyphenyl) Ether |
| 4,4'-(m-Phenylenedioxy)diphenol |
| 4,4'-[1,3-Phenylenebis(oxy)]diphenol |