S,S'-bis(tert-butyloxycarbonyl-cysteinylalanine methyl ester) structure
|
Common Name | S,S'-bis(tert-butyloxycarbonyl-cysteinylalanine methyl ester) | ||
|---|---|---|---|---|
| CAS Number | 126686-69-9 | Molecular Weight | 610.74100 | |
| Density | 1.227g/cm3 | Boiling Point | 755.2ºC at 760mmHg | |
| Molecular Formula | C24H42N4O10S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 410.5ºC | |
| Name | methyl (2S)-2-[[(2R)-3-[[(2R)-3-[[(2S)-1-methoxy-1-oxopropan-2-yl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]disulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.227g/cm3 |
|---|---|
| Boiling Point | 755.2ºC at 760mmHg |
| Molecular Formula | C24H42N4O10S2 |
| Molecular Weight | 610.74100 |
| Flash Point | 410.5ºC |
| Exact Mass | 610.23400 |
| PSA | 252.02000 |
| LogP | 3.59920 |
| Vapour Pressure | 1.07E-22mmHg at 25°C |
| Index of Refraction | 1.516 |
| InChIKey | GAZAMNFVEISLQY-VGWMRTNUSA-N |
| SMILES | COC(=O)C(C)NC(=O)C(CSSCC(NC(=O)OC(C)(C)C)C(=O)NC(C)C(=O)OC)NC(=O)OC(C)(C)C |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| disulfide dimer of Boc-L-Cys-L-Ala-OMe |