N-(2-Benzoyl-4-chloro-phenyl)-2-(2-hydroxy-2-phenyl-ethylamino)-acetamide; compound with (Z)-but-2-enedioic acid structure
|
Common Name | N-(2-Benzoyl-4-chloro-phenyl)-2-(2-hydroxy-2-phenyl-ethylamino)-acetamide; compound with (Z)-but-2-enedioic acid | ||
|---|---|---|---|---|
| CAS Number | 126517-32-6 | Molecular Weight | 524.95000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H25ClN2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(2-Benzoyl-4-chloro-phenyl)-2-(2-hydroxy-2-phenyl-ethylamino)-acetamide; compound with (Z)-but-2-enedioic acid |
|---|
| Molecular Formula | C27H25ClN2O7 |
|---|---|
| Molecular Weight | 524.95000 |
| Exact Mass | 524.13500 |
| PSA | 153.03000 |
| LogP | 4.00840 |
| InChIKey | SSJOWDIOBSHYQN-WLHGVMLRSA-N |
| SMILES | O=C(CNCC(O)c1ccccc1)Nc1ccc(Cl)cc1C(=O)c1ccccc1.O=C(O)C=CC(=O)O |