2-[[2-(4-methoxyphenyl)chromen-4-ylidene]amino]acetic acid
Modify Date: 2025-09-11 11:41:01
![2-[[2-(4-methoxyphenyl)chromen-4-ylidene]amino]acetic acid Structure](https://image.chemsrc.com/caspic/010/126480-34-0.png)
2-[[2-(4-methoxyphenyl)chromen-4-ylidene]amino]acetic acid structure
|
Common Name | 2-[[2-(4-methoxyphenyl)chromen-4-ylidene]amino]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 126480-34-0 | Molecular Weight | 309.31600 | |
| Density | 1.24g/cm3 | Boiling Point | 472.8ºC at 760mmHg | |
| Molecular Formula | C18H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.8ºC | |
| Name | 2-[[2-(4-methoxyphenyl)chromen-4-ylidene]amino]acetic acid |
|---|
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 472.8ºC at 760mmHg |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.31600 |
| Flash Point | 239.8ºC |
| Exact Mass | 309.10000 |
| PSA | 72.03000 |
| LogP | 3.09370 |
| Vapour Pressure | 9.58E-10mmHg at 25°C |
| Index of Refraction | 1.602 |
| InChIKey | ZZMFXBDIIUKDJM-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cc(=NCC(=O)O)c3ccccc3o2)cc1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |