4-Acetyl-5-methoxy-1,3-phenylene dibenzoate structure
|
Common Name | 4-Acetyl-5-methoxy-1,3-phenylene dibenzoate | ||
|---|---|---|---|---|
| CAS Number | 126381-85-9 | Molecular Weight | 390.38500 | |
| Density | 1.252g/cm3 | Boiling Point | 598.842ºC at 760 mmHg | |
| Molecular Formula | C23H18O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.305ºC | |
| Name | 4-Acetyl-5-methoxy-1,3-phenylene dibenzoate |
|---|
| Density | 1.252g/cm3 |
|---|---|
| Boiling Point | 598.842ºC at 760 mmHg |
| Molecular Formula | C23H18O6 |
| Molecular Weight | 390.38500 |
| Flash Point | 261.305ºC |
| Exact Mass | 390.11000 |
| PSA | 78.90000 |
| LogP | 4.33620 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.597 |
| InChIKey | PXWWNDCAEQROPL-UHFFFAOYSA-N |
| SMILES | COc1cc(OC(=O)c2ccccc2)cc(OC(=O)c2ccccc2)c1C(C)=O |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |