SKF107457 structure
|
Common Name | SKF107457 | ||
|---|---|---|---|---|
| CAS Number | 126333-28-6 | Molecular Weight | 577.71300 | |
| Density | 1.154g/cm3 | Boiling Point | 897.8ºC at 760 mmHg | |
| Molecular Formula | C29H47N5O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 496.8ºC | |
Use of SKF107457SKF107457 is an HIV-1 protease inhibitor that can be used in AIDS research[1][2]. |
| Name | methyl (2S)-2-[[(2S)-2-[[(4S,5S)-5-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl]amino]-4-hydroxy-6-phenylhexanoyl]amino]-3-methylbutanoyl]amino]-3-methylbutanoate |
|---|---|
| Synonym | More Synonyms |
| Description | SKF107457 is an HIV-1 protease inhibitor that can be used in AIDS research[1][2]. |
|---|---|
| Related Catalog | |
| Target |
HIV-1 protease[1][2]. |
| Density | 1.154g/cm3 |
|---|---|
| Boiling Point | 897.8ºC at 760 mmHg |
| Molecular Formula | C29H47N5O7 |
| Molecular Weight | 577.71300 |
| Flash Point | 496.8ºC |
| Exact Mass | 577.34800 |
| PSA | 202.91000 |
| LogP | 4.22300 |
| Vapour Pressure | 1.13E-34mmHg at 25°C |
| Index of Refraction | 1.528 |
| InChIKey | IUDCAKKZLXFOQA-QJAPXLAMSA-N |
| SMILES | COC(=O)C(NC(=O)C(NC(=O)CCC(O)C(Cc1ccccc1)NC(=O)C(C)NC(=O)C(C)N)C(C)C)C(C)C |
| 1aaq |
| 1heg |
| C-terminal inhibitor 1 |
| 1siv |