Methyl 7-bromo-2H-chromene-3-carboxylate structure
|
Common Name | Methyl 7-bromo-2H-chromene-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1263285-65-9 | Molecular Weight | 269.09100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Methyl 7-bromo-2H-chromene-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H9BrO3 |
|---|---|
| Molecular Weight | 269.09100 |
| Exact Mass | 267.97400 |
| PSA | 35.53000 |
| LogP | 2.39790 |
| InChIKey | WDRUUWPEQBSXRD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=Cc2ccc(Br)cc2OC1 |
| HS Code | 2916190090 |
|---|
| HS Code | 2916190090 |
|---|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| methyl 7-bromo-2H-chromene-3-carboxylate |