1-Benzyl-2-azido-1H-indole-3-carbaldehyde
Modify Date: 2025-08-23 17:43:52
1-Benzyl-2-azido-1H-indole-3-carbaldehyde structure
|
Common Name | 1-Benzyl-2-azido-1H-indole-3-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 126177-54-6 | Molecular Weight | 276.29300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-Benzyl-2-azido-1H-indole-3-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H12N4O |
|---|---|
| Molecular Weight | 276.29300 |
| Exact Mass | 276.10100 |
| PSA | 71.75000 |
| LogP | 3.89666 |
| InChIKey | DOVRYMNAFBWMMQ-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=Nc1c(C=O)c2ccccc2n1Cc1ccccc1 |
|
~%
1-Benzyl-2-azid... CAS#:126177-54-6 |
| Literature: Erba, Emanuela; Pocar, Donato; Valle, Marinella Journal of the Chemical Society - Perkin Transactions 1, 1999 , # 4 p. 421 - 425 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
![2-AMINO-3-METHYL-9H-PYRIDO[2,3-B]INDOLE structure](https://image.chemsrc.com/caspic/242/68006-83-7.png)
CAS#:68006-83-7| .1-benzyl-2-azido-indol-3-carbaldehyde |
| 2-azido-1-benzyl-indole-3-carboxaldehyde |