4-nitro-2-[3-(trifluoromethoxy)phenyl]benzoic acid
Modify Date: 2026-07-03 02:14:50
![4-nitro-2-[3-(trifluoromethoxy)phenyl]benzoic acid Structure](https://image.chemsrc.com/caspic/101/1261663-87-9.png)
4-nitro-2-[3-(trifluoromethoxy)phenyl]benzoic acid structure
|
Common Name | 4-nitro-2-[3-(trifluoromethoxy)phenyl]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 1261663-87-9 | Molecular Weight | 327.21200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H8F3NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-nitro-2-[3-(trifluoromethoxy)phenyl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H8F3NO5 |
|---|---|
| Molecular Weight | 327.21200 |
| Exact Mass | 327.03500 |
| PSA | 92.35000 |
| LogP | 4.38180 |
| InChIKey | NQEPWPGKHRVVLZ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])cc1-c1cccc(OC(F)(F)F)c1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-nitro-2-(3-trifluoromethoxyphenyl)benzoic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4-nitro-2-[3-(trifluoromethoxy)phenyl]benzoic acid? |
| A: CAS number of 4-nitro-2-[3-(trifluoromethoxy)phenyl]benzoic acid is 1261663-87-9. |
| Q: What English synonyms does 4-nitro-2-[3-(trifluoromethoxy)phenyl]benzoic acid have? |
| A: English synonyms of 4-nitro-2-[3-(trifluoromethoxy)phenyl]benzoic acid: 4-nitro-2-(3-trifluoromethoxyphenyl)benzoic acid. |
| Q: What is the English name of 4-nitro-2-[3-(trifluoromethoxy)phenyl]benzoic acid? |
| A: The English name of 4-nitro-2-[3-(trifluoromethoxy)phenyl]benzoic acid is 4-nitro-2-[3-(trifluoromethoxy)phenyl]benzoic acid. |
| Q: What is the polar surface area (PSA) of 4-nitro-2-[3-(trifluoromethoxy)phenyl]benzoic acid? |
| A: Polar surface area (PSA) of 4-nitro-2-[3-(trifluoromethoxy)phenyl]benzoic acid is 92.35000. |
| Q: What is the molecular formula of 4-nitro-2-[3-(trifluoromethoxy)phenyl]benzoic acid? |
| A: Molecular formula of 4-nitro-2-[3-(trifluoromethoxy)phenyl]benzoic acid is C14H8F3NO5. |
| Q: What is the Chinese name of 1261663-87-9? |
| A: Chinese name of 1261663-87-9 is 1261663-87-9. |
| Q: What is the SMILES notation of 4-nitro-2-[3-(trifluoromethoxy)phenyl]benzoic acid? |
| A: SMILES notation of 4-nitro-2-[3-(trifluoromethoxy)phenyl]benzoic acid is O=C(O)c1ccc([N+](=O)[O-])cc1-c1cccc(OC(F)(F)F)c1. |
| Q: What is the molecular weight of 4-nitro-2-[3-(trifluoromethoxy)phenyl]benzoic acid? |
| A: Molecular weight of 4-nitro-2-[3-(trifluoromethoxy)phenyl]benzoic acid is 327.21200. |
| Q: What is the LogP of 4-nitro-2-[3-(trifluoromethoxy)phenyl]benzoic acid? |
| A: LogP of 4-nitro-2-[3-(trifluoromethoxy)phenyl]benzoic acid is 4.38180. |
| Q: What is the InChIKey of 4-nitro-2-[3-(trifluoromethoxy)phenyl]benzoic acid? |
| A: InChIKey of 4-nitro-2-[3-(trifluoromethoxy)phenyl]benzoic acid is NQEPWPGKHRVVLZ-UHFFFAOYSA-N. |