Phosphoric trichloride, polymer with 1,3-benzenediol, phenyl ester structure
|
Common Name | Phosphoric trichloride, polymer with 1,3-benzenediol, phenyl ester | ||
|---|---|---|---|---|
| CAS Number | 125997-21-9 | Molecular Weight | N/A | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H24O4P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Phosphoric trichloride, polymer with 1,3-benzenediol, phenyl ester |
|---|
| Molecular Formula | C30H24O4P2 |
|---|---|
| InChIKey | WRAUFVTWUWFMJW-UHFFFAOYSA-N |
| SMILES | O=P(Cl)(Cl)Cl.Oc1cccc(O)c1.Oc1ccccc1 |