4-[4-(4-carbamimidoyl-2-methoxyphenoxy)butoxy]-3-methoxybenzenecarboximidamide structure
|
Common Name | 4-[4-(4-carbamimidoyl-2-methoxyphenoxy)butoxy]-3-methoxybenzenecarboximidamide | ||
|---|---|---|---|---|
| CAS Number | 125880-91-3 | Molecular Weight | 386.44500 | |
| Density | 1.25g/cm3 | Boiling Point | 574.4ºC at 760mmHg | |
| Molecular Formula | C20H26N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 301.2ºC | |
| Name | 4-[4-(4-carbamimidoyl-2-methoxyphenoxy)butoxy]-3-methoxybenzenecarboximidamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 574.4ºC at 760mmHg |
| Molecular Formula | C20H26N4O4 |
| Molecular Weight | 386.44500 |
| Flash Point | 301.2ºC |
| Exact Mass | 386.19500 |
| PSA | 136.66000 |
| LogP | 4.11000 |
| Vapour Pressure | 3.38E-13mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | AWCKLOPZHLHTAD-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=N)N)ccc1OCCCCOc1ccc(C(=N)N)cc1OC |
|
~%
4-[4-(4-carbami... CAS#:125880-91-3 |
| Literature: Tidwell; Jones; Geratz; Ohemeng; Cory; Hall Journal of Medicinal Chemistry, 1990 , vol. 33, # 4 p. 1252 - 1257 |
|
~%
4-[4-(4-carbami... CAS#:125880-91-3 |
| Literature: Tidwell; Jones; Geratz; Ohemeng; Cory; Hall Journal of Medicinal Chemistry, 1990 , vol. 33, # 4 p. 1252 - 1257 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4,4'-(1,4-Butanediylbis(oxy))bis(3-methoxybenzenecarboximidamide) |
| 1,4-Di(4-amidino-2-methoxyphenoxy)butane |
| Dimethoxybutane |