ethyl 2-[(4-chlorophenoxy)methyl]benzoate
Modify Date: 2025-11-25 20:28:56
![ethyl 2-[(4-chlorophenoxy)methyl]benzoate Structure](https://image.chemsrc.com/caspic/426/1257524-52-9.png)
ethyl 2-[(4-chlorophenoxy)methyl]benzoate structure
|
Common Name | ethyl 2-[(4-chlorophenoxy)methyl]benzoate | ||
|---|---|---|---|---|
| CAS Number | 1257524-52-9 | Molecular Weight | 290.74200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-[(4-chlorophenoxy)methyl]benzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H15ClO3 |
|---|---|
| Molecular Weight | 290.74200 |
| Exact Mass | 290.07100 |
| PSA | 35.53000 |
| LogP | 4.09570 |
| InChIKey | WLUORBQBSNGBEW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccccc1COc1ccc(Cl)cc1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Ethyl 2-((4-chlorophenoxy)methyl)benzoate |