UDP-2-acetamido-2-deoxygalacturonic acid
Modify Date: 2025-09-09 11:04:53
UDP-2-acetamido-2-deoxygalacturonic acid structure
|
Common Name | UDP-2-acetamido-2-deoxygalacturonic acid | ||
|---|---|---|---|---|
| CAS Number | 125710-37-4 | Molecular Weight | 621.33700 | |
| Density | 1.92g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H25N3O18P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [[[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] (2R,3S,4S,5S)-5-acetamido-3,4,6-trihydroxyoxane-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.92g/cm3 |
|---|---|
| Molecular Formula | C17H25N3O18P2 |
| Molecular Weight | 621.33700 |
| Exact Mass | 621.06100 |
| PSA | 346.30000 |
| Index of Refraction | 1.66 |
| InChIKey | PPKWAUXLIQKSTC-GGTZVBJBSA-N |
| SMILES | CC(=O)NC1C(O)OC(C(=O)OP(=O)(O)OP(=O)(O)OCC2OC(n3ccc(=O)[nH]c3=O)C(O)C2O)C(O)C1O |
| Udp-2-acetamido-2-deoxygalacturonic acid |
| Udp-adg |
| L-Galactopyranuronic acid,2-(acetylamino)-2-deoxy-,1-P'-ester with uridine 5'-(trihydrogen diphosphate) |