8-(2-methylsulfanylethyl)-9,9-dioxo-9$l^{6}-thia-8-azabicyclo[4.3.0]no na-1,3,5-trien-7-one structure
|
Common Name | 8-(2-methylsulfanylethyl)-9,9-dioxo-9$l^{6}-thia-8-azabicyclo[4.3.0]no na-1,3,5-trien-7-one | ||
|---|---|---|---|---|
| CAS Number | 125698-32-0 | Molecular Weight | 257.32900 | |
| Density | 1.424g/cm3 | Boiling Point | 445.9ºC at 760 mmHg | |
| Molecular Formula | C10H11NO3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.5ºC | |
| Name | 2-(2-methylsulfanylethyl)-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.424g/cm3 |
|---|---|
| Boiling Point | 445.9ºC at 760 mmHg |
| Molecular Formula | C10H11NO3S2 |
| Molecular Weight | 257.32900 |
| Flash Point | 223.5ºC |
| Exact Mass | 257.01800 |
| PSA | 88.13000 |
| LogP | 2.21280 |
| Vapour Pressure | 3.8E-08mmHg at 25°C |
| Index of Refraction | 1.627 |
| InChIKey | PCOYTLGIKATEHT-UHFFFAOYSA-N |
| SMILES | CSCCN1C(=O)c2ccccc2S1(=O)=O |
|
~%
8-(2-methylsulf... CAS#:125698-32-0 |
| Literature: Journal of Pharmaceutical Sciences, , vol. 78, # 11 p. 903 - 909 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 8-(2-methylsulfanylethyl)-9,9-dioxo-9 |
| l^{6}-thia-8-azabicyclo[4.3.0]no na-1,3,5-trien-7-one |
| 2-(2-(Methylthio)ethyl)-1,2-benzisothiazol-3(2H)-one-1,1-dioxide |
| 1,2-Benzisothiazol-3(2H)-one,2-[2-(methylthio)ethyl]-,1,1-dioxide |