[3-[(4-cyanophenyl)methoxy]phenyl]boronic acid
Modify Date: 2025-08-26 19:53:44
![[3-[(4-cyanophenyl)methoxy]phenyl]boronic acid Structure](https://image.chemsrc.com/caspic/488/1256355-72-2.png)
[3-[(4-cyanophenyl)methoxy]phenyl]boronic acid structure
|
Common Name | [3-[(4-cyanophenyl)methoxy]phenyl]boronic acid | ||
|---|---|---|---|---|
| CAS Number | 1256355-72-2 | Molecular Weight | 253.06100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12BNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [3-[(4-cyanophenyl)methoxy]phenyl]boronic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H12BNO3 |
|---|---|
| Molecular Weight | 253.06100 |
| Exact Mass | 253.09100 |
| PSA | 73.48000 |
| LogP | 0.81708 |
| InChIKey | NWEBJLANUDYFMY-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(COc2cccc(B(O)O)c2)cc1 |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| x1963 |
| 3-(4-cyanophenylmethoxy)phenylboronic acid |