4-(3-Methylbutanoyl)phenylboronic acid structure
|
Common Name | 4-(3-Methylbutanoyl)phenylboronic acid | ||
|---|---|---|---|---|
| CAS Number | 1256346-29-8 | Molecular Weight | 206.04600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15BO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(3-Methylbutanoyl)phenylboronic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H15BO3 |
|---|---|
| Molecular Weight | 206.04600 |
| Exact Mass | 206.11100 |
| PSA | 57.53000 |
| LogP | 0.59520 |
| InChIKey | HFIQYDWQIGRTGC-UHFFFAOYSA-N |
| SMILES | CC(C)CC(=O)c1ccc(B(O)O)cc1 |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| [4-(3-Methylbutanoyl)phenyl]boronic acid |