(S)-Bepotastine
(S)-Bepotastine structure
|
Common Name | (S)-Bepotastine | ||
|---|---|---|---|---|
| CAS Number | 125602-71-3 | Molecular Weight | 388.888 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 546.8±50.0 °C at 760 mmHg | |
| Molecular Formula | C21H25ClN2O3 | Melting Point | 56-58 °C | |
| MSDS | N/A | Flash Point | 284.5±30.1 °C | |
Use of (S)-BepotastineBepotastine is an orally active second-generation histamine H1 receptor antagonist. Bepotastine has the potential for allergic rhinitis and urticaria/pruritus treatment[1][2]. |
| Name | bepotastine |
|---|---|
| Synonym | More Synonyms |
| Description | Bepotastine is an orally active second-generation histamine H1 receptor antagonist. Bepotastine has the potential for allergic rhinitis and urticaria/pruritus treatment[1][2]. |
|---|---|
| Related Catalog | |
| Target |
Histamine H1 receptor[1] |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 546.8±50.0 °C at 760 mmHg |
| Melting Point | 56-58 °C |
| Molecular Formula | C21H25ClN2O3 |
| Molecular Weight | 388.888 |
| Flash Point | 284.5±30.1 °C |
| Exact Mass | 388.155365 |
| PSA | 62.66000 |
| LogP | 3.67 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.605 |
| InChIKey | YWGDOWXRIALTES-NRFANRHFSA-N |
| SMILES | O=C(O)CCCN1CCC(OC(c2ccc(Cl)cc2)c2ccccn2)CC1 |
| Hazard Codes | Xn |
|---|
|
(S)-Bepotastine CAS#:125602-71-3 ~64%
(S)-Bepotastine CAS#:125602-71-3 |
| Literature: Ha, Tae Hee; Suh, Kwee-Hyun; Lee, Gwan Sun Bulletin of the Korean Chemical Society, 2013 , vol. 34, # 2 p. 549 - 552 |
|
(S)-Bepotastine CAS#:125602-71-3 ~68%
(S)-Bepotastine CAS#:125602-71-3 |
| Literature: Hanmi Pharm. Co., Ltd. Patent: US2010/137367 A1, 2010 ; Location in patent: Page/Page column 3 ; |
|
~%
(S)-Bepotastine CAS#:125602-71-3 |
| Literature: US2014/46068 A1, ; |
|
~%
(S)-Bepotastine CAS#:125602-71-3 |
| Literature: US2014/46068 A1, ; |
|
~%
(S)-Bepotastine CAS#:125602-71-3 |
| Literature: US2014/46068 A1, ; |
![2-[(4-Chlorophenyl)(4-piperidinyloxy)methyl]pyridine structure](https://image.chemsrc.com/caspic/160/122368-54-1.png)
| (+)-(S)-4-[4-[(4-chlorophenyl)(2-pyridyl)methoxy]piperidino]butyric acid monobenzenesulfonate |
| 4-[(S)-(4-chlorophenyl)-2-pyridinylMethoxy] |
| 4-{4-[(S)-(4-Chlorophenyl)(2-pyridinyl)methoxy]-1-piperidinyl}butanoic acid |
| (+)-(S)-4-{4[(4-chlorphenyl)(2-pyridil)methoxy]piperidino}butyric acid monobenzenesulfonate |
| 1-Piperidinebutanoic acid, 4-[(S)-(4-chlorophenyl)-2-pyridinylmethoxy]- |
| 1-Piperidinebutanoic acid,4-[(S)-(4-chlorophenyl)-2-pyridinylmethoxy] |
| 4-[4-[(4-Chlorophenyl)pyridin-2-ylmethoxy]piperidin-1-yl]butanoic acid |
| (+)-(S)-4-[4-[1-(4-chlorophenyl)-1-(2-pyridyl)methoxy]piperidin-1-yl]butyric acid |
| [14C]-Bepotastine besilate |
| Bepotastine |
| 4-(4-[(1S)(4-CHLOROPHENYL)-2-PYRIDYLMETHOXY]PIPERIDYL)BUTANOIC ACID |
| betotastine besilate |
| 4-(4-((S)-(4-Chlorophenyl)(pyridin-2-yl)methoxy)piperidin-1-yl)butanoic Acid |
| (+)-4-(((S)-p-Chloro-2-pyridylbenzyl)oxy)-1-piperidinebutyric Acid |
| betotastine |
| Bepreve |
| 4-{4-[(S)-(4-Chlorophenyl)(pyridin-2-yl)methoxy]piperidin-1-yl}butanoic acid |