(R)-(-)-mandelic acid salt of (R)-methyl 3-amino-4-(2,4,5-trifluorophenyl)butanoate
Modify Date: 2025-08-28 13:14:40
(R)-(-)-mandelic acid salt of (R)-methyl 3-amino-4-(2,4,5-trifluorophenyl)butanoate structure
|
Common Name | (R)-(-)-mandelic acid salt of (R)-methyl 3-amino-4-(2,4,5-trifluorophenyl)butanoate | ||
|---|---|---|---|---|
| CAS Number | 1253055-94-5 | Molecular Weight | 399.361 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H20F3NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (R)-(-)-mandelic acid salt of (R)-methyl 3-amino-4-(2,4,5-trifluorophenyl)butanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H20F3NO5 |
|---|---|
| Molecular Weight | 399.361 |
| Exact Mass | 399.129364 |
| PSA | 109.85000 |
| LogP | 3.04170 |
| InChIKey | JBYIIBSXNYSNPK-HFEGYEGKSA-N |
| SMILES | COC(=O)CC(N)Cc1cc(F)c(F)cc1F.O=C(O)C(O)c1ccccc1 |
| methyl (3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoate (R)-(-)-mandelate salt |
| (2R)-Hydroxy(phenyl)acetic acid - methyl (3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoate (1:1) |
| methyl (3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoate (R)-(-)-mandelate |
| (R)-methyl 3-amino-4-(2,4,5-trifluorophenyl) butanoate .(R)-2-hydroxy-2-phenylacetate |