4-[(1R)-1-hydroxy-2-[4-(4-hydroxyphenyl)butylamino]ethyl]benzene-1,2-diol,hydrochloride structure
|
Common Name | 4-[(1R)-1-hydroxy-2-[4-(4-hydroxyphenyl)butylamino]ethyl]benzene-1,2-diol,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 125251-66-3 | Molecular Weight | 317.38000 | |
| Density | 1.262g/cm3 | Boiling Point | 578.3ºC at 760mmHg | |
| Molecular Formula | C18H23NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.1ºC | |
Use of 4-[(1R)-1-hydroxy-2-[4-(4-hydroxyphenyl)butylamino]ethyl]benzene-1,2-diol,hydrochlorideArbutamine hydrochloride is a short-acting, potent and nonselective β-adrenoceptor agonist. Arbutamine hydrochloride stimulates cardiac β1-, tracheal β2-, and adiopocyte β3- adrenergic receptors. Arbutamine hydrochloride provides cardiac stress increases heart rate, cardiac contractility, and systolic blood pressure. Arbutamine hydrochloride can be used for cardiac stress agent [1][2][3]. |
| Name | 4-[(1R)-1-hydroxy-2-[4-(4-hydroxyphenyl)butylamino]ethyl]benzene-1,2-diol,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | Arbutamine hydrochloride is a short-acting, potent and nonselective β-adrenoceptor agonist. Arbutamine hydrochloride stimulates cardiac β1-, tracheal β2-, and adiopocyte β3- adrenergic receptors. Arbutamine hydrochloride provides cardiac stress increases heart rate, cardiac contractility, and systolic blood pressure. Arbutamine hydrochloride can be used for cardiac stress agent [1][2][3]. |
|---|---|
| Related Catalog | |
| In Vitro | Arbutamine hydrochloride (0.1-100 nM) increases heart contractile force and pD2 value of 8.45. Arbutamine has the affinity constants (KA) value of 7.32 for cardiac β1-adrenergic receptors[3]. |
| In Vivo | Arbutamine hydrochloride (i.v.; 5, 10, 50, 100 and 250 ng/kg) increases mean heart rate, peak positive left ventricular pressure and its first time-derivative, and normal-zone myocardial thickening in 8 open-chest dogs (mean weight, 26.91 kg). |
| References |
| Density | 1.262g/cm3 |
|---|---|
| Boiling Point | 578.3ºC at 760mmHg |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38000 |
| Flash Point | 195.1ºC |
| Exact Mass | 317.16300 |
| PSA | 92.95000 |
| LogP | 2.84020 |
| Vapour Pressure | 3.24E-14mmHg at 25°C |
| Index of Refraction | 1.631 |
| InChIKey | ATBUNPBAFFCFKY-FERBBOLQSA-N |
| SMILES | Cl.Oc1ccc(CCCCNCC(O)c2ccc(O)c(O)c2)cc1 |
| Arbutamine HCl |
| Genesa (TN) |
| Arbutamine hydrochloride |
| Arbutamine hydrochloride [USAN] |
| C18H23NO4.HCl |
| UNII-K0NF2CPJ7F |