1-(2-hydroxyethoxymethyl)-6-(4-methoxyphenyl)sulfanyl-5-methylpyrimidine-2,4-dione
Modify Date: 2025-11-13 12:08:33
1-(2-hydroxyethoxymethyl)-6-(4-methoxyphenyl)sulfanyl-5-methylpyrimidine-2,4-dione structure
|
Common Name | 1-(2-hydroxyethoxymethyl)-6-(4-methoxyphenyl)sulfanyl-5-methylpyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 125083-80-9 | Molecular Weight | 338.37900 | |
| Density | 1.39g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H18N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2-hydroxyethoxymethyl)-6-(4-methoxyphenyl)sulfanyl-5-methylpyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Molecular Formula | C15H18N2O5S |
| Molecular Weight | 338.37900 |
| Exact Mass | 338.09400 |
| PSA | 119.11000 |
| LogP | 1.38350 |
| Index of Refraction | 1.63 |
| InChIKey | DWMGGBXPBFYIBI-UHFFFAOYSA-N |
| SMILES | COc1ccc(Sc2c(C)c(=O)[nH]c(=O)n2COCCO)cc1 |
|
~%
1-(2-hydroxyeth... CAS#:125083-80-9 |
| Literature: Journal of Medicinal Chemistry, , vol. 35, # 2 p. 337 - 345 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4'-MeOHEPT |
| 2,4(1H,3H)-Pyrimidinedione,1-[(2-hydroxyethoxy)methyl]-6-[(4-methoxyphenyl)thio]-5-methyl |
| 1-((2-Hydroxyethoxy)methyl)-6-((4-methoxyphenyl)thio)thymine |