1-(2-hydroxyethoxymethyl)-5-methyl-6-(2-phenylethynyl)pyrimidine-2,4-dione
Modify Date: 2025-09-04 10:51:01
1-(2-hydroxyethoxymethyl)-5-methyl-6-(2-phenylethynyl)pyrimidine-2,4-dione structure
|
Common Name | 1-(2-hydroxyethoxymethyl)-5-methyl-6-(2-phenylethynyl)pyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 125056-87-3 | Molecular Weight | 300.30900 | |
| Density | 1.34g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2-hydroxyethoxymethyl)-5-methyl-6-(2-phenylethynyl)pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.30900 |
| Exact Mass | 300.11100 |
| PSA | 84.58000 |
| LogP | 0.62350 |
| Index of Refraction | 1.63 |
| InChIKey | ILALPBPUIYQOBN-UHFFFAOYSA-N |
| SMILES | Cc1c(C#Cc2ccccc2)n(COCCO)c(=O)[nH]c1=O |
|
~%
1-(2-hydroxyeth... CAS#:125056-87-3 |
| Literature: Journal of Medicinal Chemistry, , vol. 34, # 1 p. 349 - 357 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
![1-(2-hydroxyethoxymethyl)-5-methyl-6-[(Z)-2-phenylethenyl]pyrimidine-2,4-dione structure](https://image.chemsrc.com/caspic/240/131194-19-9.png)
CAS#:131194-19-9| 1(OHEtOMe)-6(PhEthynyl)T |
| 2,4(1H,3H)-Pyrimidinedione,1-[(2-hydroxyethoxy)methyl]-5-methyl-6-(2-phenylethynyl) |
| 1-[(2-Hydroxyethoxy)methyl]-6-(2-phenylethynyl)thymine |
| 2,4(1H,3H)-Pyrimidinedione,1-[(2-hydroxyethoxy)methyl]-5-methyl-6-(phenylethynyl) |